|
CAS#: 62663-25-6 Product: (2-Phenyl-1H-Indol-1-Yl)Acetic Acid No suppilers available for the product. |
| Name | (2-Phenyl-1H-Indol-1-Yl)Acetic Acid |
|---|---|
| Synonyms | 2-(2-Phenyl-1-Indolyl)Acetate; 2-(2-Phenylindol-1-Yl)Ethanoate; Zinc03888670 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12NO2 |
| Molecular Weight | 250.28 |
| CAS Registry Number | 62663-25-6 |
| SMILES | C1=C([N](C2=CC=CC=C12)CC([O-])=O)C3=CC=CC=C3 |
| InChI | 1S/C16H13NO2/c18-16(19)11-17-14-9-5-4-8-13(14)10-15(17)12-6-2-1-3-7-12/h1-10H,11H2,(H,18,19)/p-1 |
| InChIKey | RVIREVUBJAFZHA-UHFFFAOYSA-M |
| Boiling point | 497.941°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 254.946°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2-Phenyl-1H-Indol-1-Yl)Acetic Acid |