Online Database of Chemicals from Around the World
|
CAS#: 62671-38-9 Product: 5,5'-Dithiobis(1-Methyltetrazole) No suppilers available for the product. |
| Name | 5,5'-Dithiobis(1-Methyltetrazole) |
|---|---|
| Synonyms | 1-Methyl-5-(1-Methyltetrazol-5-Yl)Disulfanyl-Tetrazole; 1-Methyl-5-[(1-Methyl-5-Tetrazolyl)Disulfanyl]Tetrazole; 1-Methyl-5-[(1-Methyl-1,2,3,4-Tetrazol-5-Yl)Disulfanyl]-1,2,3,4-Tetrazole |
| Molecular Structure |  |
| Molecular Formula | C4H6N8S2 |
| Molecular Weight | 230.27 |
| CAS Registry Number | 62671-38-9 |
| SMILES | C[N]1C(=NN=N1)SSC2=NN=N[N]2C |
| InChI | 1S/C4H6N8S2/c1-11-3(5-7-9-11)13-14-4-6-8-10-12(4)2/h1-2H3 |
| InChIKey | FOTIRCKWBGLFNQ-UHFFFAOYSA-N |
| Density | 1.966g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.076°C at 760 mmHg (Cal.) |
| Flash point | 252.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Dithiobis(1-Methyltetrazole) |