Online Database of Chemicals from Around the World
|
CAS#: 6268-26-4 Product: N,N'-Bis(4-aminophenyl)-Thiourea No suppilers available for the product. |
| Name | N,N'-Bis(4-aminophenyl)-Thiourea |
|---|---|
| Synonyms | Nsc37102; Thiocarbanilide, 4,4'-Diamino-; Thiourea, N,N'-Bis(4-Aminophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.34 |
| CAS Registry Number | 6268-26-4 |
| SMILES | C2=C(NC(=S)NC1=CC=C(N)C=C1)C=CC(=C2)N |
| InChI | 1S/C13H14N4S/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,14-15H2,(H2,16,17,18) |
| InChIKey | BOXVYMDQQMOOGS-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.872°C at 760 mmHg (Cal.) |
| Flash point | 239.785°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(4-aminophenyl)-Thiourea |