Online Database of Chemicals from Around the World
|
CAS#: 6270-75-3 Product: 2-(1-Propenyl)-Benzothiazole No suppilers available for the product. |
| Name | 2-(1-Propenyl)-Benzothiazole |
|---|---|
| Synonyms | 2-Prop-1-Enyl-1,3-Benzothiazole; Nsc35808 |
| Molecular Structure |  |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.25 |
| CAS Registry Number | 6270-75-3 |
| SMILES | C1=CC=CC2=C1SC(=N2)\C=C\C |
| InChI | 1S/C10H9NS/c1-2-5-10-11-8-6-3-4-7-9(8)12-10/h2-7H,1H3/b5-2+ |
| InChIKey | QLIMKQNGGOYBRL-GORDUTHDSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.947°C at 760 mmHg (Cal.) |
| Flash point | 137.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Propenyl)-Benzothiazole |