| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,3S,7S,8S)-2-Oxa-6-azatricyclo[4.2.1.03,7]nonan-8-ol |
|---|---|
| Synonyms | (1S,6R,7S,7aS)-hexahydro-1H-1,6-epoxypyrrolizin-7-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 |
| CAS Registry Number | 627079-69-0 |
| SMILES | O[C@H]2[C@@H]3N1CC[C@@H]3O[C@@H]2C1 |
| InChI | 1S/C7H11NO2/c9-7-5-3-8-2-1-4(10-5)6(7)8/h4-7,9H,1-3H2/t4-,5+,6+,7+/m0/s1 |
| InChIKey | FHBDVCMHSWWTIZ-BDVNFPICSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.245°C at 760 mmHg (Cal.) |
| Flash point | 111.192°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| (1) | R. S. Glass, D. R. Deardorff, N. Y. T. Stessman and M. D. Carducci. (1[alpha],6[alpha],7[alpha],7a[beta])-2,3,5,6,7,7a-Hexahydro-1,6-epoxy-1H-pyrrolizin-7-ol, Acta Cryst. (2003). E59, o1270-o1271 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,3S,7S,8S)-2-Oxa-6-azatricyclo[4.2.1.03,7]nonan-8-ol |