|
CAS#: 62726-91-4 Product: D-alpha-Tocopherol Quinone No suppilers available for the product. |
| Name | D-alpha-Tocopherol Quinone |
|---|---|
| Synonyms | 2-[(3R,7R,11R)-3-Hydroxy-3,7,11,15-Tetramethyl-Hexadecyl]-1,4-Benzoquinone; 2-[(3R,7R,11R)-3-Hydroxy-3,7,11,15-Tetramethylhexadecyl]-1,4-Benzoquinone; 2-[(3R,7R,11R)-3-Hydroxy-3,7,11,15-Tetramethyl-Hexadecyl]-P-Benzoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.63 |
| CAS Registry Number | 62726-91-4 |
| SMILES | [C@@](CCC1=CC(=O)C=CC1=O)(O)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | 1S/C26H44O3/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5,29)18-16-23-19-24(27)14-15-25(23)28/h14-15,19-22,29H,6-13,16-18H2,1-5H3/t21-,22-,26-/m1/s1 |
| InChIKey | RYDAONHARCBTNC-XLGIIRLISA-N |
| Density | 0.969g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.799°C at 760 mmHg (Cal.) |
| Flash point | 274.393°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-alpha-Tocopherol Quinone |