Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | Pulvinic anhydride |
|---|---|
| Synonyms | 3,6-Di(Phenyl)Furo[5,4-D]Furan-2,5-Quinone; Pulvic Dilactone; Pulvinic Acid Lactone |
| Molecular Structure |  |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 6273-79-6 |
| SMILES | C4=C(C3=C2C(=C(C1=CC=CC=C1)C(O2)=O)OC3=O)C=CC=C4 |
| InChI | 1S/C18H10O4/c19-17-13(11-7-3-1-4-8-11)15-16(22-17)14(18(20)21-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KQTXUHHOWJUFOZ-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.267°C at 760 mmHg (Cal.) |
| Flash point | 290.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pulvinic anhydride |