Online Database of Chemicals from Around the World
|
CAS#: 62782-12-1 Product: 1-Nitro-2,3,7,8-Tetrachlorodibenzo-p-Dioxin No suppilers available for the product. |
| Name | 1-Nitro-2,3,7,8-Tetrachlorodibenzo-p-Dioxin |
|---|---|
| Synonyms | 2,3,7,8-Tetrachloro-1-Nitro-Oxanthrene; 1-Nitro-2,3,7,8-Tetrachlorodibenzo-P-Dioxin; Dibenzo-P-Dioxin, 1-Nitro-2,3,7,8-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl4NO4 |
| Molecular Weight | 366.97 |
| CAS Registry Number | 62782-12-1 |
| SMILES | C1=C(Cl)C(=C([N+]([O-])=O)C2=C1OC3=C(O2)C=C(Cl)C(=C3)Cl)Cl |
| InChI | 1S/C12H3Cl4NO4/c13-4-1-7-8(2-5(4)14)21-12-9(20-7)3-6(15)10(16)11(12)17(18)19/h1-3H |
| InChIKey | IXSTUEXABKYCLK-UHFFFAOYSA-N |
| Density | 1.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.784°C at 760 mmHg (Cal.) |
| Flash point | 239.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2,3,7,8-Tetrachlorodibenzo-p-Dioxin |