|
CAS#: 6279-07-8 Product: 2-Methyl-9H-Xanthene No suppilers available for the product. |
| Name | 2-Methyl-9H-Xanthene |
|---|---|
| Synonyms | Nsc11168 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 6279-07-8 |
| SMILES | C1=C(C=CC3=C1CC2=C(C=CC=C2)O3)C |
| InChI | 1S/C14H12O/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)15-14/h2-8H,9H2,1H3 |
| InChIKey | DWWOIEMBMCUMRM-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.544°C at 760 mmHg (Cal.) |
| Flash point | 148.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-9H-Xanthene |