|
CAS#: 6284-98-6 Product: 1-(2-Methylbutan-2-Yl)-4-Nitro-Benzene No suppilers available for the product. |
| Name | 1-(2-Methylbutan-2-Yl)-4-Nitro-Benzene |
|---|---|
| Synonyms | 1-(1,1-Dimethylpropyl)-4-Nitro-Benzene; 1-(1,1-Dimethylpropyl)-4-Nitrobenzene; 1-Tert-Amyl-4-Nitro-Benzene |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 6284-98-6 |
| SMILES | C1=C(C(CC)(C)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C11H15NO2/c1-4-11(2,3)9-5-7-10(8-6-9)12(13)14/h5-8H,4H2,1-3H3 |
| InChIKey | LLLHRFJRKDQEIY-UHFFFAOYSA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.129°C at 760 mmHg (Cal.) |
| Flash point | 110.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methylbutan-2-Yl)-4-Nitro-Benzene |