Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 8-Amino-1-Phenazinol |
|---|---|
| Synonyms | 1-Phenazinol,8-amino-; 8-aminophenazin-1-ol |
| Molecular Structure |  |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 |
| CAS Registry Number | 62842-50-6 |
| SMILES | c1cc2c(c(c1)O)nc3cc(ccc3n2)N |
| InChI | 1S/C12H9N3O/c13-7-4-5-8-10(6-7)15-12-9(14-8)2-1-3-11(12)16/h1-6,16H,13H2 |
| InChIKey | UGHMMOVTJJZYMM-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.701°C at 760 mmHg (Cal.) |
| Flash point | 265.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Amino-1-Phenazinol |