|
CAS#: 629662-41-5 Product: Ethyl 8-(benzyloxy)-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate No suppilers available for the product. |
| Name | Ethyl 8-(benzyloxy)-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |
|---|---|
| Synonyms | Azepino[4 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.47 |
| CAS Registry Number | 629662-41-5 |
| SMILES | CCOC(=O)C1=CNCC(c2c1[nH]c3c2ccc(c3)OCc4ccccc4)(C)C |
| InChI | 1S/C24H26N2O3/c1-4-28-23(27)19-13-25-15-24(2,3)21-18-11-10-17(12-20(18)26-22(19)21)29-14-16-8-6-5-7-9-16/h5-13,25-26H,4,14-15H2,1-3H3 |
| InChIKey | QXIBLGIBKFQSDW-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.615°C at 760 mmHg (Cal.) |
| Flash point | 318.855°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 8-(benzyloxy)-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |