|
CAS#: 629663-24-7 Product: Ethyl 9-amino-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate No suppilers available for the product. |
| Name | Ethyl 9-amino-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |
|---|---|
| Synonyms | Azepino[4 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 |
| CAS Registry Number | 629663-24-7 |
| SMILES | CCOC(=O)C1=CNCC(c2c1[nH]c3c2cc(cc3)N)(C)C |
| InChI | 1S/C17H21N3O2/c1-4-22-16(21)12-8-19-9-17(2,3)14-11-7-10(18)5-6-13(11)20-15(12)14/h5-8,19-20H,4,9,18H2,1-3H3 |
| InChIKey | DCAPZFWGHRYYIP-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.189°C at 760 mmHg (Cal.) |
| Flash point | 287.149°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 9-amino-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |