Online Database of Chemicals from Around the World
|
CAS#: 62967-27-5 Product: 4-(4-Nitroanilino)Phenyl Isocyanate No suppilers available for the product. |
| Name | 4-(4-Nitroanilino)Phenyl Isocyanate |
|---|---|
| Synonyms | N-(4-Isocyanatophenyl)-4-Nitro-Aniline; (4-Isocyanatophenyl)-(4-Nitrophenyl)Amine; (P-(P-Nitroanilino)Phenyl)Isocyanic Acid |
| Molecular Structure |  |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 |
| CAS Registry Number | 62967-27-5 |
| SMILES | O=C=NC2=CC=C(NC1=CC=C([N+]([O-])=O)C=C1)C=C2 |
| InChI | 1S/C13H9N3O3/c17-9-14-10-1-3-11(4-2-10)15-12-5-7-13(8-6-12)16(18)19/h1-8,15H |
| InChIKey | QSGQZDCTAJVFHA-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.356°C at 760 mmHg (Cal.) |
| Flash point | 212.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Nitroanilino)Phenyl Isocyanate |