Online Database of Chemicals from Around the World
| Name | Heptabromodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,4,6,7,8-Heptabromo-; Heptabromodibenzofuran |
| Molecular Structure |  |
| Molecular Formula | C12HBr7O |
| Molecular Weight | 720.47 |
| CAS Registry Number | 62994-32-5 (107555-95-3) |
| EINECS | 263-781-9 |
| SMILES | C3=C2C1=C(C(=C(C(=C1OC2=C(C(=C3Br)Br)Br)Br)Br)Br)Br |
| InChI | 1S/C12HBr7O/c13-3-1-2-4-6(15)7(16)8(17)10(19)12(4)20-11(2)9(18)5(3)14/h1H |
| InChIKey | JISOUFWSRUCDMJ-UHFFFAOYSA-N |
| Density | 2.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 611.231°C at 760 mmHg (Cal.) |
| Flash point | 323.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptabromodibenzofuran |
