Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2,3,3-trimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |
|---|---|
| Synonyms | methyl 2, |
| Molecular Structure | ![CAS#: 630106-39-7， Methyl 2,3,3-trimethyltricyclo[2.2.1.0<sup>2,6</sup>]heptane-1-carboxylate](/moreStructures/630106-39-7.gif) |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 630106-39-7 |
| SMILES | CC1(C2CC3C1(C3(C2)C(=O)OC)C)C |
| InChI | 1S/C12H18O2/c1-10(2)7-5-8-11(10,3)12(8,6-7)9(13)14-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | IWXDXJPNYTVITL-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.716°C at 760 mmHg (Cal.) |
| Flash point | 80.954°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,3,3-trimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |