|
CAS#: 6302-46-1 Product: 1-(4-Chlorophenyl)-N-(4-Methylpentan-2-Yl)Ethanimine No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-N-(4-Methylpentan-2-Yl)Ethanimine |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-N-(1,3-Dimethylbutyl)Ethanimine; 1-(4-Chlorophenyl)Ethylidene-(1,3-Dimethylbutyl)Amine; Nsc42219 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 |
| CAS Registry Number | 6302-46-1 |
| SMILES | C1=CC(=CC=C1C(=NC(CC(C)C)C)C)Cl |
| InChI | 1S/C14H20ClN/c1-10(2)9-11(3)16-12(4)13-5-7-14(15)8-6-13/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | DRIAUPOMKDASET-UHFFFAOYSA-N |
| Density | 0.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.887°C at 760 mmHg (Cal.) |
| Flash point | 131.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-N-(4-Methylpentan-2-Yl)Ethanimine |