Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Aminonaphthalene-1,4-Dione |
|---|---|
| Synonyms | 5-Amino-1,4-Naphthoquinone; 1,4-Naphthoquinone, 5-Amino-; Nsc150274 |
| Molecular Structure |  |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 63038-00-6 |
| SMILES | C1=CC=C(C2=C1C(=O)C=CC2=O)N |
| InChI | 1S/C10H7NO2/c11-7-3-1-2-6-8(12)4-5-9(13)10(6)7/h1-5H,11H2 |
| InChIKey | PRIYDLUXFBTENF-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.173°C at 760 mmHg (Cal.) |
| Flash point | 195.818°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Aminonaphthalene-1,4-Dione |