Online Database of Chemicals from Around the World
|
CAS#: 63040-49-3 Product: 5,6-Dimethoxydibenz[a,h]Anthracene No suppilers available for the product. |
| Name | 5,6-Dimethoxydibenz[a,h]Anthracene |
|---|---|
| Synonyms | 3,4-Dimethoxy-1,2:5,6-Dibenzanthracene; 3,4-Dimethoxy-Dba; 4-06-00-07046 (Beilstein Handbook Reference) |
| Molecular Structure | ![CAS#: 63040-49-3， 5,6-Dimethoxydibenz[a,h]Anthracene](/moreStructures/63040-49-3.gif) |
| Molecular Formula | C24H18O2 |
| Molecular Weight | 338.41 |
| CAS Registry Number | 63040-49-3 |
| SMILES | C1=C4C(=CC2=C3C(=CC=C12)C=CC=C3)C(=C(C5=C4C=CC=C5)OC)OC |
| InChI | 1S/C24H18O2/c1-25-23-19-10-6-5-9-18(19)21-13-16-12-11-15-7-3-4-8-17(15)20(16)14-22(21)24(23)26-2/h3-14H,1-2H3 |
| InChIKey | CTLSVZBGALBGBV-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.501°C at 760 mmHg (Cal.) |
| Flash point | 230.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethoxydibenz[a,h]Anthracene |