Online Database of Chemicals from Around the World
|
CAS#: 63040-53-9 Product: Benzo[rst]Pentaphene-5-Carbaldehyde No suppilers available for the product. |
| Name | Benzo[rst]Pentaphene-5-Carbaldehyde |
|---|---|
| Synonyms | 5-Formyl-3,4:9,10-Dibenzopyrene; Benzo(Rst)Pentaphene-5-Carboxaldehyde; Brn 2594144 |
| Molecular Structure | ![CAS#: 63040-53-9， Benzo[rst]Pentaphene-5-Carbaldehyde](/moreStructures/63040-53-9.gif) |
| Molecular Formula | C25H14O |
| Molecular Weight | 330.39 |
| CAS Registry Number | 63040-53-9 |
| SMILES | C2=CC1=C6C(=CC4=C1C3=C2C5=C(C(=C3C=C4)C=O)C=CC=C5)C=CC=C6 |
| InChI | 1S/C25H14O/c26-14-23-19-8-4-3-7-18(19)21-12-11-20-17-6-2-1-5-15(17)13-16-9-10-22(23)25(21)24(16)20/h1-14H |
| InChIKey | KXXBSQCVRSXSMB-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.896°C at 760 mmHg (Cal.) |
| Flash point | 419.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[rst]Pentaphene-5-Carbaldehyde |