Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Amino-6-Quinolinecarboxylic Acid 1-Oxide |
|---|---|
| Synonyms | 4-amino-6-carboxyquinoline 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 63040-96-0 |
| SMILES | c1cc2c(cc1C(=O)O)c(cc[n+]2[O-])N |
| InChI | 1S/C10H8N2O3/c11-8-3-4-12(15)9-2-1-6(10(13)14)5-7(8)9/h1-5H,11H2,(H,13,14) |
| InChIKey | JLBHDDPZRMTLRG-UHFFFAOYSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.796°C at 760 mmHg (Cal.) |
| Flash point | 253.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-6-Quinolinecarboxylic Acid 1-Oxide |