Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Methyldibenz[a,h]Anthracene |
|---|---|
| Synonyms | 3-Methyldibenz(A,H)Anthracene; Brn 3310872; Dibenz(A,H)Anthracene, 3-Methyl- |
| Molecular Structure | ![CAS#: 63041-84-9， 3-Methyldibenz[a,h]Anthracene](/moreStructures/63041-84-9.gif) |
| Molecular Formula | C23H16 |
| Molecular Weight | 292.38 |
| CAS Registry Number | 63041-84-9 |
| SMILES | C2=C1C=CC5=C(C1=CC4=C2C3=C(C=C(C)C=C3)C=C4)C=CC=C5 |
| InChI | 1S/C23H16/c1-15-6-11-21-17(12-15)9-10-19-13-22-18(14-23(19)21)8-7-16-4-2-3-5-20(16)22/h2-14H,1H3 |
| InChIKey | HWPZEPGEOVIYMU-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.031°C at 760 mmHg (Cal.) |
| Flash point | 271.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyldibenz[a,h]Anthracene |