Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| BroadPharm. Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 536-7788 | |||
|
sales@broadpharm.com | |||
| Chemical manufacturer | ||||
| Name | 2-(4-chlorophenyl)-N-hydroxy-2-oxo-ethanimidoyl chloride |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-N-Hydroxy-2-Oxo-Acetimidoyl Chloride; 2-(4-Chlorophenyl)-N-Hydroxy-2-Oxoacetimidoyl Chloride; 2-(4-Chlorophenyl)-N-Hydroxy-2-Keto-Acetimidoyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 |
| CAS Registry Number | 6305-05-1 |
| SMILES | C1=CC(=CC=C1C(\C(=N\O)Cl)=O)Cl |
| InChI | 1S/C8H5Cl2NO2/c9-6-3-1-5(2-4-6)7(12)8(10)11-13/h1-4,13H/b11-8- |
| InChIKey | KPMRXNMLJSQAQE-FLIBITNWSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.23°C at 760 mmHg (Cal.) |
| Flash point | 180.733°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(4-chlorophenyl)-N-hydroxy-2-oxo-ethanimidoyl chloride |