Online Database of Chemicals from Around the World
|
CAS#: 6310-99-2 Product: 1,4-Dibromo-2,6-Dinitrobenzene No suppilers available for the product. |
| Name | 1,4-Dibromo-2,6-Dinitrobenzene |
|---|---|
| Synonyms | 2,5-Dibromo-1,3-Dinitro-Benzene; Benzene, 1,4-Dibromo-2,6-Dinitro-; Nsc43987 |
| Molecular Structure |  |
| Molecular Formula | C6H2Br2N2O4 |
| Molecular Weight | 325.90 |
| CAS Registry Number | 6310-99-2 |
| SMILES | C1=C(Br)C=C([N+]([O-])=O)C(=C1[N+]([O-])=O)Br |
| InChI | 1S/C6H2Br2N2O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H |
| InChIKey | YTLIABVCBVXIJL-UHFFFAOYSA-N |
| Density | 2.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.418°C at 760 mmHg (Cal.) |
| Flash point | 129.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dibromo-2,6-Dinitrobenzene |