| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 5-Chloro-3-Ethyl-2-Methylbenzothiazolium p-Toluenesulfonate |
|---|---|
| Synonyms | 5-Chloro-3-Ethyl-2-Methylbenzothiazolium P-Toluenesulphonate; Benzothiazolium, 5-Chloro-3-Ethyl-2-Methyl-, Salt With 4-Methylbenzenesulfonic Acid (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18ClNO3S2 |
| Molecular Weight | 383.91 |
| CAS Registry Number | 63149-16-6 |
| EINECS | 263-959-6 |
| SMILES | C1=C(Cl)C=CC2=C1[N+](=C(C)S2)CC.C3=CC(=CC=C3[S](=O)(=O)[O-])C |
| InChI | 1S/C10H11ClNS.C7H8O3S/c1-3-12-7(2)13-10-5-4-8(11)6-9(10)12;1-6-2-4-7(5-3-6)11(8,9)10/h4-6H,3H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | GYXTWUJZURSNCF-UHFFFAOYSA-M |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-3-Ethyl-2-Methylbenzothiazolium p-Toluenesulfonate |