Online Database of Chemicals from Around the World
|
CAS#: 63155-83-9 Product: 5-Oxo-L-Propyl-L-Prolinamide No suppilers available for the product. |
| Name | 5-Oxo-L-Propyl-L-Prolinamide |
|---|---|
| Synonyms | (2S)-5-Oxo-N-Propyl-Pyrrolidine-2-Carboxamide; (2S)-5-Oxo-N-Propyl-2-Pyrrolidinecarboxamide; (2S)-5-Keto-N-Propyl-Pyrrolidine-2-Carboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 63155-83-9 |
| EINECS | 263-972-7 |
| SMILES | [C@@H]1(NC(=O)CC1)C(=O)NCCC |
| InChI | 1S/C8H14N2O2/c1-2-5-9-8(12)6-3-4-7(11)10-6/h6H,2-5H2,1H3,(H,9,12)(H,10,11)/t6-/m0/s1 |
| InChIKey | VFKVIVDERFUZPW-LURJTMIESA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.925°C at 760 mmHg (Cal.) |
| Flash point | 218.052°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Oxo-L-Propyl-L-Prolinamide |