Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Isopropyl-1,2-Naphthalenedione |
|---|---|
| Synonyms | 5-isopropylnaphthalene-1,2-dione |
| Molecular Structure |  |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 63166-22-3 |
| SMILES | CC(C)c1cccc2c1C=CC(=O)C2=O |
| InChI | 1S/C13H12O2/c1-8(2)9-4-3-5-11-10(9)6-7-12(14)13(11)15/h3-8H,1-2H3 |
| InChIKey | VTIHQCKKJVPMPK-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.084°C at 760 mmHg (Cal.) |
| Flash point | 137.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-1,2-Naphthalenedione |