Online Database of Chemicals from Around the World
|
CAS#: 6321-40-0 Product: Tris(2-Methylallyl)Amine No suppilers available for the product. |
| Name | Tris(2-Methylallyl)Amine |
|---|---|
| Synonyms | Tris(2-Methylprop-2-Enyl)Amine; Tris(2-Methylallyl)Amine; Nsc32646 |
| Molecular Structure |  |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.30 |
| CAS Registry Number | 6321-40-0 |
| EINECS | 228-674-3 |
| SMILES | C(N(CC(C)=C)CC(C)=C)C(C)=C |
| InChI | 1S/C12H21N/c1-10(2)7-13(8-11(3)4)9-12(5)6/h1,3,5,7-9H2,2,4,6H3 |
| InChIKey | FXBJYRVIFGLPBC-UHFFFAOYSA-N |
| Density | 0.82g/cm3 (Cal.) |
|---|---|
| Boiling point | 194.898°C at 760 mmHg (Cal.) |
| Flash point | 53.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2-Methylallyl)Amine |