|
CAS#: 63216-61-5 Product: 9,12-Dibromotricyclo[6.2.2.02,7]Dodeca-2,4,6-Triene No suppilers available for the product. |
| Name | 9,12-Dibromotricyclo[6.2.2.02,7]Dodeca-2,4,6-Triene |
|---|---|
| Synonyms | 2,10-Dibromo-1,2,3,4-tetrahydro-1,4-ethanonaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12Br2 |
| Molecular Weight | 316.03 |
| CAS Registry Number | 63216-61-5 |
| SMILES | c1ccc2c(c1)C3CC(C2C(C3)Br)Br |
| InChI | 1S/C12H12Br2/c13-10-5-7-6-11(14)12(10)9-4-2-1-3-8(7)9/h1-4,7,10-12H,5-6H2 |
| InChIKey | VRUXOMKEGZYBGP-UHFFFAOYSA-N |
| Density | 1.741g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.962°C at 760 mmHg (Cal.) |
| Flash point | 203.015°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,12-Dibromotricyclo[6.2.2.02,7]Dodeca-2,4,6-Triene |