Online Database of Chemicals from Around the World
|
CAS#: 6336-79-4 Product: 1,2-Diacetoxynaphthalene No suppilers available for the product. |
| Name | 1,2-Diacetoxynaphthalene |
|---|---|
| Synonyms | (2-Acetoxy-1-Naphthyl) Acetate; Acetic Acid (2-Acetoxy-1-Naphthyl) Ester; (2-Acetyloxynaphthalen-1-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 6336-79-4 |
| SMILES | C2=CC1=CC=CC=C1C(=C2OC(=O)C)OC(=O)C |
| InChI | 1S/C14H12O4/c1-9(15)17-13-8-7-11-5-3-4-6-12(11)14(13)18-10(2)16/h3-8H,1-2H3 |
| InChIKey | YLAVAANBVJPQIB-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.119°C at 760 mmHg (Cal.) |
| Flash point | 196.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Diacetoxynaphthalene |