| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3-diisocyanatomethyl-Benzene polymer with 1,6-diisocyanatohexane |
|---|---|
| Synonyms | 1,6-Diisocyanatohexane; 1,3-Diisocyanato-2-Methyl-Benzene; Benzene, 1,3-Diisocyanatomethyl-, Polymer With 1,6-Diisocyanatohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.35 |
| CAS Registry Number | 63368-95-6 |
| SMILES | O=C=NC1=C(C(=CC=C1)N=C=O)C.O=C=NCCCCCCN=C=O |
| InChI | 1S/C9H6N2O2.C8H12N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;11-7-9-5-3-1-2-4-6-10-8-12/h2-4H,1H3;1-6H2 |
| InChIKey | ZOJLMJDYCXVMRM-UHFFFAOYSA-N |
| Boiling point | 248.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-diisocyanatomethyl-Benzene polymer with 1,6-diisocyanatohexane |