Online Database of Chemicals from Around the World
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (71) 858-2020 | |||
 |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-3-Bromoanthraquinone |
|---|---|
| Synonyms | 2-Amino-3-Bromo-Anthracene-9,10-Dione; 2-Amino-3-Bromo-9,10-Anthraquinone; 9,10-Anthracenedione, 2-Amino-3-Bromo- |
| Molecular Structure |  |
| Molecular Formula | C14H8BrNO2 |
| Molecular Weight | 302.13 |
| CAS Registry Number | 6337-00-4 |
| EINECS | 228-721-8 |
| SMILES | C1=C2C(=CC(=C1Br)N)C(=O)C3=C(C2=O)C=CC=C3 |
| InChI | 1S/C14H8BrNO2/c15-11-5-9-10(6-12(11)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,16H2 |
| InChIKey | CLWMYQQCXBSIBF-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.357°C at 760 mmHg (Cal.) |
| Flash point | 267.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3-Bromoanthraquinone |