Online Database of Chemicals from Around the World
|
CAS#: 63378-85-8 Product: 1,2-Bis(1-Methylethyl)-1,2-Diphenyl-Hydrazine No suppilers available for the product. |
| Name | 1,2-Bis(1-Methylethyl)-1,2-Diphenyl-Hydrazine |
|---|---|
| Synonyms | 1,2-Diisopropyl-1,2-Di(Phenyl)Hydrazine; Hydrazine,1,2-Bis(1-Methylethyl)-1,2-Diphenyl-; Hydrazine, 1,2-Bis(1-Methylethyl)-1,2-Diphenyl- |
| Molecular Structure |  |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 |
| CAS Registry Number | 63378-85-8 |
| SMILES | C2=C(N(N(C(C)C)C1=CC=CC=C1)C(C)C)C=CC=C2 |
| InChI | 1S/C18H24N2/c1-15(2)19(17-11-7-5-8-12-17)20(16(3)4)18-13-9-6-10-14-18/h5-16H,1-4H3 |
| InChIKey | QIPLTXUHTDKPTE-UHFFFAOYSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.885°C at 760 mmHg (Cal.) |
| Flash point | 148.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(1-Methylethyl)-1,2-Diphenyl-Hydrazine |