Online Database of Chemicals from Around the World
|
CAS#: 63390-11-4 Product: 3,5-Dichlorobenzidine No suppilers available for the product. |
| Name | 3,5-Dichlorobenzidine |
|---|---|
| Synonyms | 4-(4-Aminophenyl)-2,6-Dichloro-Aniline; [4-(4-Aminophenyl)-2,6-Dichloro-Phenyl]Amine; (1,1'-Biphenyl)-4,4'-Diamine, 3,5-Dichloro- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 |
| CAS Registry Number | 63390-11-4 |
| SMILES | C2=C(C1=CC=C(N)C=C1)C=C(Cl)C(=C2Cl)N |
| InChI | 1S/C12H10Cl2N2/c13-10-5-8(6-11(14)12(10)16)7-1-3-9(15)4-2-7/h1-6H,15-16H2 |
| InChIKey | BFIXSNRLSBRJQT-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.936°C at 760 mmHg (Cal.) |
| Flash point | 185.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichlorobenzidine |