Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Ethoxy-2,3,5-trimethylphenyl)ethanamine |
|---|---|
| Synonyms | 1-(4-ethoxy-2,3,5-trimethylphenyl)ethanamine |
| Molecular Structure |  |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.31 |
| CAS Registry Number | 634149-76-1 |
| SMILES | O(c1c(c(c(cc1C)C(N)C)C)C)CC |
| InChI | 1S/C13H21NO/c1-6-15-13-8(2)7-12(11(5)14)9(3)10(13)4/h7,11H,6,14H2,1-5H3 |
| InChIKey | ITUXEBMIXRNDSZ-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.552°C at 760 mmHg (Cal.) |
| Flash point | 131.698°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Ethoxy-2,3,5-trimethylphenyl)ethanamine |