Online Database of Chemicals from Around the World
|
CAS#: 63425-00-3 Product: Methuenine No suppilers available for the product. |
| Name | Methuenine |
|---|---|
| Synonyms | Methuenine |
| Molecular Structure |  |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 |
| CAS Registry Number | 63425-00-3 |
| SMILES | [C@H]3\4[C@H](CC1=C([NH]C2=C1C=CC=C2)C(=O)C3)CN(CC4=C/C)C |
| InChI | 1S/C19H22N2O/c1-3-12-10-21(2)11-13-8-16-14-6-4-5-7-17(14)20-19(16)18(22)9-15(12)13/h3-7,13,15,20H,8-11H2,1-2H3/b12-3-/t13-,15+/m1/s1 |
| InChIKey | GCVROCDNUNQXAD-DFZYWPJISA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.916°C at 760 mmHg (Cal.) |
| Flash point | 244.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methuenine |