Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Bromo-2-Naphthyl Acetate |
|---|---|
| Synonyms | (6-Bromo-2-Naphthyl) Acetate; Acetic Acid (6-Bromo-2-Naphthyl) Ester; (6-Bromonaphthalen-2-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.11 |
| CAS Registry Number | 6343-72-2 |
| EINECS | 228-740-1 |
| SMILES | C1=C(OC(C)=O)C=CC2=C1C=CC(=C2)Br |
| InChI | 1S/C12H9BrO2/c1-8(14)15-12-5-3-9-6-11(13)4-2-10(9)7-12/h2-7H,1H3 |
| InChIKey | IXQUUGRFWVXBEZ-UHFFFAOYSA-N |
| Density | 1.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.067°C at 760 mmHg (Cal.) |
| Flash point | 173.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-2-Naphthyl Acetate |