Online Database of Chemicals from Around the World
|
CAS#: 63451-42-3 Product: 9,10-Dihydro-9,9-Dimethyl-2-(1-Methylethyl)Acridine No suppilers available for the product. |
| Name | 9,10-Dihydro-9,9-Dimethyl-2-(1-Methylethyl)Acridine |
|---|---|
| Synonyms | 2-Isopropyl-9,9-Dimethyl-10H-Acridine; 9,10-Dihydro-9,9-Dimethyl-2-(1-Methylethyl)Acridine |
| Molecular Structure |  |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 |
| CAS Registry Number | 63451-42-3 |
| EINECS | 264-200-1 |
| SMILES | C1=C(C(C)C)C=CC2=C1C(C3=C(N2)C=CC=C3)(C)C |
| InChI | 1S/C18H21N/c1-12(2)13-9-10-17-15(11-13)18(3,4)14-7-5-6-8-16(14)19-17/h5-12,19H,1-4H3 |
| InChIKey | VHXQUJDDGXZCDP-UHFFFAOYSA-N |
| Density | 1.003g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.306°C at 760 mmHg (Cal.) |
| Flash point | 169.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-9,9-Dimethyl-2-(1-Methylethyl)Acridine |