Online Database of Chemicals from Around the World
|
CAS#: 63483-95-4 Product: Desisopropylprocaterol No suppilers available for the product. |
| Name | Desisopropylprocaterol |
|---|---|
| Synonyms | 5-(2-Amino-1-Hydroxy-Butyl)-8-Hydroxy-1H-Quinolin-2-One; 5-(2-Amino-1-Hydroxy-Butyl)-8-Hydroxy-Carbostyril; Desisopropylprocaterol |
| Molecular Structure |  |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 63483-95-4 |
| SMILES | C2=C(C1=C(NC(=O)C=C1)C(=C2)O)C(O)C(N)CC |
| InChI | 1S/C13H16N2O3/c1-2-9(14)13(18)8-3-5-10(16)12-7(8)4-6-11(17)15-12/h3-6,9,13,16,18H,2,14H2,1H3,(H,15,17) |
| InChIKey | PNWVJRLGSQVYBD-UHFFFAOYSA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.018°C at 760 mmHg (Cal.) |
| Flash point | 287.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desisopropylprocaterol |