Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N8,9-Diethyl-9H-purine-6,8-diamine |
|---|---|
| Synonyms | N8,9-diethyl-9H-purine-6,8-diamine |
| Molecular Structure |  |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 |
| CAS Registry Number | 634924-91-7 |
| SMILES | n1c(c2nc(n(c2nc1)CC)NCC)N |
| InChI | 1S/C9H14N6/c1-3-11-9-14-6-7(10)12-5-13-8(6)15(9)4-2/h5H,3-4H2,1-2H3,(H,11,14)(H2,10,12,13) |
| InChIKey | QNBDNRXFNRVSEU-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.527°C at 760 mmHg (Cal.) |
| Flash point | 203.894°C (Cal.) |
| Refractive index | 1.709 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N8,9-Diethyl-9H-purine-6,8-diamine |