Online Database of Chemicals from Around the World
|
CAS#: 635-50-7 Product: Porphyrin C No suppilers available for the product. |
| Name | Porphyrin C |
|---|---|
| Synonyms | Porphyrin C |
| Molecular Structure |  |
| Molecular Formula | C40H48N6O8S2 |
| Molecular Weight | 804.97 |
| CAS Registry Number | 635-50-7 |
| SMILES | C(C1=C(C3=NC1=CC5=NC(=CC2=C(C(=C([NH]2)C=C4[NH]C(=C3)C(=C4C)C(SCC(N)C(O)=O)C)C(SCC(N)C(O)=O)C)C)C(=C5CCC(O)=O)C)C)CC(O)=O |
| InChI | 1S/C40H48N6O8S2/c1-17-23(7-9-35(47)48)31-14-32-24(8-10-36(49)50)18(2)28(44-32)12-33-38(22(6)56-16-26(42)40(53)54)20(4)30(46-33)13-34-37(21(5)55-15-25(41)39(51)52)19(3)29(45-34)11-27(17)43-31/h11-14,21-22,25-26,45-46H,7-10,15-16,41-42H2,1-6H3,(H,47,48)(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | LSZWIZMWKSTIGI-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 1302.693°C at 760 mmHg (Cal.) |
| Flash point | 741.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Porphyrin C |