| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Dyes and pigments >> Dyes >> Solvent dye |
|---|---|
| Name | Solvent Violet 38 |
| Synonyms | 1,4-Bis[(2,6-Dibromo-4-Methyl-Phenyl)Amino]Anthracene-9,10-Dione; 1,4-Bis[(2,6-Dibromo-4-Methyl-Phenyl)Amino]-9,10-Anthraquinone; 1,4-Bis((2,6-Dibromo-4-Methylphenyl)Amino)Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C28H18Br4N2O2 |
| Molecular Weight | 734.08 |
| CAS Registry Number | 63512-14-1 (68239-76-9) |
| SMILES | C1=C(C=C(C(=C1Br)NC4=C3C(=O)C2=C(C=CC=C2)C(C3=C(C=C4)NC5=C(Br)C=C(C=C5Br)C)=O)Br)C |
| InChI | 1S/C28H18Br4N2O2/c1-13-9-17(29)25(18(30)10-13)33-21-7-8-22(34-26-19(31)11-14(2)12-20(26)32)24-23(21)27(35)15-5-3-4-6-16(15)28(24)36/h3-12,33-34H,1-2H3 |
| InChIKey | MBBKLLKQAYFPGR-UHFFFAOYSA-N |
| Density | 1.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.362°C at 760 mmHg (Cal.) |
| Flash point | 369.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Solvent Violet 38 |