Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-[[4-(Dimethylamino)Phenyl]Amino]Phenol |
|---|---|
| Synonyms | Phenol, 4-((4-(Dimethylamino)Phenyl)Amino)-; 4-((4-(Dimethylamino)Phenyl)Amino)Phenol |
| Molecular Structure | ![CAS#: 6358-22-1， 4-[[4-(Dimethylamino)Phenyl]Amino]Phenol](/moreStructures/6358-22-1.gif) |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 |
| CAS Registry Number | 6358-22-1 |
| EINECS | 228-764-2 |
| SMILES | C1=CC(=CC=C1O)NC2=CC=C(C=C2)N(C)C |
| InChI | 1S/C14H16N2O/c1-16(2)13-7-3-11(4-8-13)15-12-5-9-14(17)10-6-12/h3-10,15,17H,1-2H3 |
| InChIKey | PUYVXGYHLVKSKH-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.029°C at 760 mmHg (Cal.) |
| Flash point | 189.078°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[[4-(Dimethylamino)Phenyl]Amino]Phenol |