Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(4-Nitrophenyl)-1H-Imidazo(4,5-b)Pyridine |
|---|---|
| Synonyms | 2-(4-Nitrophenyl)-1H-Imidazo(4,5-B)Pyridine; 1H-Imidazo(4,5-B)Pyridine, 2-(4-Nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 |
| CAS Registry Number | 63581-48-6 |
| SMILES | C3=C(C2=NC1=NC=CC=C1[NH]2)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C12H8N4O2/c17-16(18)9-5-3-8(4-6-9)11-14-10-2-1-7-13-12(10)15-11/h1-7H,(H,13,14,15) |
| InChIKey | SNEPVAQSJPTXCK-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.606°C at 760 mmHg (Cal.) |
| Flash point | 255.953°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitrophenyl)-1H-Imidazo(4,5-b)Pyridine |