Online Database of Chemicals from Around the World
|
CAS#: 63589-04-8 Product: Dibromo-6,14-Dichloropyranthrene-8,16-Dione No suppilers available for the product. |
| Name | Dibromo-6,14-Dichloropyranthrene-8,16-Dione |
|---|---|
| Synonyms | 1,2-Dibromo-6,14-Dichloro-Pyranthrene-8,16-Dione; 1,2-Dibromo-6,14-Dichloro-Pyranthrene-8,16-Quinone; 8,16-Pyranthrenedione, Dibromo-6,14-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C30H10Br2Cl2O2 |
| Molecular Weight | 633.12 |
| CAS Registry Number | 63589-04-8 |
| EINECS | 264-341-9 |
| SMILES | C1=C(C(=C8C(=C1)C5=C3C(=CC(=C4C=C2C7=C(C(C6=C2C(=C34)C(=C5)C(=C6)Cl)=O)C=CC=C7)Cl)C8=O)Br)Br |
| InChI | 1S/C30H10Br2Cl2O2/c31-20-6-5-12-15-8-17-21(33)9-18-23-14(11-3-1-2-4-13(11)29(18)35)7-16-22(34)10-19(24(15)26(16)25(17)23)30(36)27(12)28(20)32/h1-10H |
| InChIKey | PFKGBHLOPWYCNL-UHFFFAOYSA-N |
| Density | 1.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 832.152°C at 760 mmHg (Cal.) |
| Flash point | 457.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibromo-6,14-Dichloropyranthrene-8,16-Dione |