Online Database of Chemicals from Around the World
|
CAS#: 63690-09-5 Product: 4,4'-Methylenebis(Benzamidine) No suppilers available for the product. |
| Name | 4,4'-Methylenebis(Benzamidine) |
|---|---|
| Synonyms | 4-[(4-Carbamimidoylphenyl)Methyl]Benzamidine; 4-(4-Amidinobenzyl)Benzamidine; Methylenediphenyl-4,4'-Diamidine |
| Molecular Structure |  |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 |
| CAS Registry Number | 63690-09-5 |
| SMILES | C1=CC(=CC=C1C(=N)N)CC2=CC=C(C=C2)C(N)=N |
| InChI | 1S/C15H16N4/c16-14(17)12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)15(18)19/h1-8H,9H2,(H3,16,17)(H3,18,19) |
| InChIKey | FTMSARBDCMBEPC-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.559°C at 760 mmHg (Cal.) |
| Flash point | 210.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenebis(Benzamidine) |