Online Database of Chemicals from Around the World
|
CAS#: 6371-31-9 Product: 4-Chloro-2-(4-Chloro-7-Methyl-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methyl-1-Benzothiophen-3(2H)-One No suppilers available for the product. |
| Name | 4-Chloro-2-(4-Chloro-7-Methyl-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methyl-1-Benzothiophen-3(2H)-One |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C18H10Cl2O2S2 |
| Molecular Weight | 393.31 |
| CAS Registry Number | 6371-31-9 |
| SMILES | O=C3c4c(Cl)ccc(c4SC3=C2Sc1c(ccc(Cl)c1C2=O)C)C |
| InChI | 1S/C18H10Cl2O2S2/c1-7-3-5-9(19)11-13(21)17(23-15(7)11)18-14(22)12-10(20)6-4-8(2)16(12)24-18/h3-6H,1-2H3 |
| InChIKey | ARWYYCYKOXYUSU-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.828°C at 760 mmHg (Cal.) |
| Flash point | 262.135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-(4-Chloro-7-Methyl-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methyl-1-Benzothiophen-3(2H)-One |