Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6,8-Dihydroxy-2-Quinolinecarboxylic Acid |
|---|---|
| Synonyms | 6,8-dihydroxyquinoline-2-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 |
| CAS Registry Number | 63713-29-1 |
| SMILES | c1cc(nc2c1cc(cc2O)O)C(=O)O |
| InChI | 1S/C10H7NO4/c12-6-3-5-1-2-7(10(14)15)11-9(5)8(13)4-6/h1-4,12-13H,(H,14,15) |
| InChIKey | STUKVCCUAVPAKK-UHFFFAOYSA-N |
| Density | 1.626g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.856°C at 760 mmHg (Cal.) |
| Flash point | 252.475°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dihydroxy-2-Quinolinecarboxylic Acid |