Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Bis(1-Methylethyl)Phenylphosphine |
|---|---|
| Synonyms | Diisopropyl-Phenyl-Phosphane; Diisopropyl-Phenylphosphane; Nsc244301 |
| Molecular Structure |  |
| Molecular Formula | C12H19P |
| Molecular Weight | 194.26 |
| CAS Registry Number | 6372-43-6 |
| SMILES | C1=C(P(C(C)C)C(C)C)C=CC=C1 |
| InChI | 1S/C12H19P/c1-10(2)13(11(3)4)12-8-6-5-7-9-12/h5-11H,1-4H3 |
| InChIKey | AIFSJAIZLCBORN-UHFFFAOYSA-N |
| Boiling point | 260.263°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1-Methylethyl)Phenylphosphine |