|
CAS#: 6375-65-1 Product: (2-Nitrophenyl)Thio]Acetic Acid No suppilers available for the product. |
| Name | (2-Nitrophenyl)Thio]Acetic Acid |
|---|---|
| Synonyms | 2-[(2-Nitrophenyl)Thio]Acetate; 2-(2-Nitrophenyl)Sulfanylethanoate; Zinc00318558 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6NO4S |
| Molecular Weight | 212.20 |
| CAS Registry Number | 6375-65-1 |
| SMILES | C1=C(SCC([O-])=O)C(=CC=C1)[N+]([O-])=O |
| InChI | 1S/C8H7NO4S/c10-8(11)5-14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,10,11)/p-1 |
| InChIKey | PINPTHMYKLERLV-UHFFFAOYSA-M |
| Boiling point | 390.639°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 190.052°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Nitrophenyl)Thio]Acetic Acid |